ChemNet > CAS > 50451-84-8 5-chloro-3-methyl-1-benzothiophene-2-carboxylic acid
50451-84-8 5-chloro-3-methyl-1-benzothiophene-2-carboxylic acid
| product Name |
5-chloro-3-methyl-1-benzothiophene-2-carboxylic acid |
| CAS No |
50451-84-8 |
| Molecular Formula |
C10H7ClO2S |
| Molecular Weight |
226.6794 |
| InChI |
InChI=1/C10H7ClO2S/c1-5-7-4-6(11)2-3-8(7)14-9(5)10(12)13/h2-4H,1H3,(H,12,13) |
| Molecular Structure |
|
| Density |
1.474g/cm3 |
| Melting point |
298℃ |
| Boiling point |
411.7°C at 760 mmHg |
| Refractive index |
1.695 |
| Flash point |
202.8°C |
| Vapour Pressur |
1.62E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
